C16H14Cl2N2OS — CID 110535626
(Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 110535626) has the molecular formula C16H14Cl2N2OS and a molecular weight of 353.27 g/mol. Its IUPAC name is (Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110535626 |
| Molecular Formula | C16H14Cl2N2OS |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCCOc1c(Cl)cc(/C=C(/C#N)c2nc(C)cs2)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N2OS/c1-3-4-21-15-13(17)6-11(7-14(15)18)5-12(8-19)16-20-10(2)9-22-16/h5-7,9H,3-4H2,1-2H3/b12-5- |
| InChIKey | XGJHVTJBAXMEQY-XGICHPGQSA-N |
| XLogP | 5.61 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|