C17H16F3N3OS — CID 8811726
(E)-2-(4-methyl-1,3-thiazol-2-yl)-3-[2-propoxy-5-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 8811726) has the molecular formula C17H16F3N3OS and a molecular weight of 367.40 g/mol. Its IUPAC name is (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-[2-propoxy-5-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-[2-propoxy-5-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 8811726 |
| Molecular Formula | C17H16F3N3OS |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-[2-propoxy-5-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1N/C=C(\C#N)c1nc(C)cs1 |
| InChI | InChI=1S/C17H16F3N3OS/c1-3-6-24-15-5-4-13(17(18,19)20)7-14(15)22-9-12(8-21)16-23-11(2)10-25-16/h4-5,7,9-10,22H,3,6H2,1-2H3/b12-9+ |
| InChIKey | YVYORIDGEAYLCD-FMIVXFBMSA-N |
| XLogP | 5.24 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|