C15H11N2O3S- — CID 9342286
2-[4-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]phenoxy]acetate (PubChem CID 9342286) has the molecular formula C15H11N2O3S- and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9342286 |
| Molecular Formula | C15H11N2O3S- |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-[4-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]phenoxy]acetate |
| SMILES | Cc1csc(/C(C#N)=C/c2ccc(OCC(=O)[O-])cc2)n1 |
| InChI | InChI=1S/C15H12N2O3S/c1-10-9-21-15(17-10)12(7-16)6-11-2-4-13(5-3-11)20-8-14(18)19/h2-6,9H,8H2,1H3,(H,18,19)/p-1/b12-6+ |
| InChIKey | UWCUCXFZYAMUJH-WUXMJOGZSA-M |
| XLogP | 1.64 |
| TPSA | 86.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|