C20H15IN2OS — CID 2840464
2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-iodophenyl)prop-2-enenitrile (PubChem CID 2840464) has the molecular formula C20H15IN2OS and a molecular weight of 458.32 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-iodophenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-iodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2840464 |
| Molecular Formula | C20H15IN2OS |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(4-iodophenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(-c2csc(C(C#N)=Cc3ccc(I)cc3)n2)cc1 |
| InChI | InChI=1S/C20H15IN2OS/c1-2-24-18-9-5-15(6-10-18)19-13-25-20(23-19)16(12-22)11-14-3-7-17(21)8-4-14/h3-11,13H,2H2,1H3 |
| InChIKey | FBMXXIQOSYELHQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|