C21H18N2OS — CID 18558306
(Z)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)prop-2-enenitrile (PubChem CID 18558306) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is (Z)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18558306 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (Z)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(-c2csc(/C(C#N)=C\c3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C21H18N2OS/c1-3-24-19-9-7-17(8-10-19)20-14-25-21(23-20)18(13-22)12-16-6-4-5-15(2)11-16/h4-12,14H,3H2,1-2H3/b18-12- |
| InChIKey | UBFHXCWDDMWRTJ-PDGQHHTCSA-N |
| XLogP | 5.58 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|