C22H21N3OS — CID 7365455
(Z)-3-(2,5-dimethylanilino)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 7365455) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is (Z)-3-(2,5-dimethylanilino)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2,5-dimethylanilino)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 7365455 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (Z)-3-(2,5-dimethylanilino)-2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CCOc1ccc(-c2csc(/C(C#N)=C\Nc3cc(C)ccc3C)n2)cc1 |
| InChI | InChI=1S/C22H21N3OS/c1-4-26-19-9-7-17(8-10-19)21-14-27-22(25-21)18(12-23)13-24-20-11-15(2)5-6-16(20)3/h5-11,13-14,24H,4H2,1-3H3/b18-13- |
| InChIKey | UCMJBJJKFNUUQP-AQTBWJFISA-N |
| XLogP | 5.80 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|