C21H19Cl2N3O — CID 110532437
(Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110532437) has the molecular formula C21H19Cl2N3O and a molecular weight of 400.31 g/mol. Its IUPAC name is (Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110532437 |
| Molecular Formula | C21H19Cl2N3O |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (Z)-3-(3,5-dichloro-4-propoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCCOc1c(Cl)cc(/C=C(/C#N)c2nc3ccccc3n2CC)cc1Cl |
| InChI | InChI=1S/C21H19Cl2N3O/c1-3-9-27-20-16(22)11-14(12-17(20)23)10-15(13-24)21-25-18-7-5-6-8-19(18)26(21)4-2/h5-8,10-12H,3-4,9H2,1-2H3/b15-10- |
| InChIKey | ZRQNJXLEXYAJDJ-GDNBJRDFSA-N |
| XLogP | 6.22 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|