C21H20ClN3O2 — CID 110533601
(Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110533601) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110533601 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2nc3ccccc3n2C)cc(Cl)c1OCC |
| InChI | InChI=1S/C21H20ClN3O2/c1-4-26-19-12-14(11-16(22)20(19)27-5-2)10-15(13-23)21-24-17-8-6-7-9-18(17)25(21)3/h6-12H,4-5H2,1-3H3/b15-10- |
| InChIKey | DCIRMESMQALDDK-GDNBJRDFSA-N |
| XLogP | 5.09 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|