C20H18BrN3O2 — CID 7912315
(E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 7912315) has the molecular formula C20H18BrN3O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7912315 |
| Molecular Formula | C20H18BrN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (E)-3-(3-bromo-4-ethoxy-5-methoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCOc1c(Br)cc(/C=C(\C#N)c2nc3ccccc3n2C)cc1OC |
| InChI | InChI=1S/C20H18BrN3O2/c1-4-26-19-15(21)10-13(11-18(19)25-3)9-14(12-22)20-23-16-7-5-6-8-17(16)24(20)2/h5-11H,4H2,1-3H3/b14-9+ |
| InChIKey | LXFWJMKZLNLHJI-NTEUORMPSA-N |
| XLogP | 4.81 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|