C27H25N3O3 — CID 110530405
(Z)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110530405) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is (Z)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110530405 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (Z)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-2-(1-ethylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCn1c(/C(C#N)=C\c2cc(OC)c(OCc3ccccc3)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C27H25N3O3/c1-4-30-23-13-9-8-12-22(23)29-27(30)21(17-28)14-20-15-24(31-2)26(25(16-20)32-3)33-18-19-10-6-5-7-11-19/h5-16H,4,18H2,1-3H3/b21-14- |
| InChIKey | NGBDROSZAKVSPM-STZFKDTASA-N |
| XLogP | 5.72 |
| TPSA | 69.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|