C23H25N3O — CID 110535164
(Z)-2-(1-ethylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile (PubChem CID 110535164) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (Z)-2-(1-ethylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1-ethylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110535164 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (Z)-2-(1-ethylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile |
| SMILES | CCCCCOc1ccc(/C=C(/C#N)c2nc3ccccc3n2CC)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-3-5-8-15-27-20-13-11-18(12-14-20)16-19(17-24)23-25-21-9-6-7-10-22(21)26(23)4-2/h6-7,9-14,16H,3-5,8,15H2,1-2H3/b19-16- |
| InChIKey | OUMWHQZKANSLEF-MNDPQUGUSA-N |
| XLogP | 5.69 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|