C22H23N3O — CID 18291334
(E)-2-(1-methylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile (PubChem CID 18291334) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is (E)-2-(1-methylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1-methylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18291334 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (E)-2-(1-methylbenzimidazol-2-yl)-3-(4-pentoxyphenyl)prop-2-enenitrile |
| SMILES | CCCCCOc1ccc(/C=C(\C#N)c2nc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C22H23N3O/c1-3-4-7-14-26-19-12-10-17(11-13-19)15-18(16-23)22-24-20-8-5-6-9-21(20)25(22)2/h5-6,8-13,15H,3-4,7,14H2,1-2H3/b18-15+ |
| InChIKey | XBKYYZIXRNPZTF-OBGWFSINSA-N |
| XLogP | 5.21 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|