C26H30ClN3O — CID 110530526
(Z)-3-(2-chloro-4-nonoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110530526) has the molecular formula C26H30ClN3O and a molecular weight of 436.00 g/mol. Its IUPAC name is (Z)-3-(2-chloro-4-nonoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2-chloro-4-nonoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110530526 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | (Z)-3-(2-chloro-4-nonoxyphenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCCCCCCCCOc1ccc(/C=C(/C#N)c2nc3ccccc3n2C)c(Cl)c1 |
| InChI | InChI=1S/C26H30ClN3O/c1-3-4-5-6-7-8-11-16-31-22-15-14-20(23(27)18-22)17-21(19-28)26-29-24-12-9-10-13-25(24)30(26)2/h9-10,12-15,17-18H,3-8,11,16H2,1-2H3/b21-17- |
| InChIKey | BUWXWKOOTBRMQE-FXBPSFAMSA-N |
| XLogP | 7.42 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|