C21H21N3O — CID 110537048
(Z)-2-(1-methylbenzimidazol-2-yl)-3-[2-(2-methylpropoxy)phenyl]prop-2-enenitrile (PubChem CID 110537048) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (Z)-2-(1-methylbenzimidazol-2-yl)-3-[2-(2-methylpropoxy)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1-methylbenzimidazol-2-yl)-3-[2-(2-methylpropoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 110537048 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (Z)-2-(1-methylbenzimidazol-2-yl)-3-[2-(2-methylpropoxy)phenyl]prop-2-enenitrile |
| SMILES | CC(C)COc1ccccc1/C=C(/C#N)c1nc2ccccc2n1C |
| InChI | InChI=1S/C21H21N3O/c1-15(2)14-25-20-11-7-4-8-16(20)12-17(13-22)21-23-18-9-5-6-10-19(18)24(21)3/h4-12,15H,14H2,1-3H3/b17-12- |
| InChIKey | PTCGWNZHOQWSFL-ATVHPVEESA-N |
| XLogP | 4.67 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|