C17H18N2OS — CID 110538667
(Z)-3-[2-(2-methylpropoxy)phenyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 110538667) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is (Z)-3-[2-(2-methylpropoxy)phenyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-(2-methylpropoxy)phenyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110538667 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (Z)-3-[2-(2-methylpropoxy)phenyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C\c2ccccc2OCC(C)C)n1 |
| InChI | InChI=1S/C17H18N2OS/c1-12(2)10-20-16-7-5-4-6-14(16)8-15(9-18)17-19-13(3)11-21-17/h4-8,11-12H,10H2,1-3H3/b15-8- |
| InChIKey | AIJLNZHPCNTYTG-NVNXTCNLSA-N |
| XLogP | 4.55 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|