C22H20N2OS — CID 7121298
(Z)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile (PubChem CID 7121298) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is (Z)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7121298 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (Z)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-ethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1ccccc1/C=C(/C#N)c1nc(-c2ccc(C)c(C)c2)cs1 |
| InChI | InChI=1S/C22H20N2OS/c1-4-25-21-8-6-5-7-18(21)12-19(13-23)22-24-20(14-26-22)17-10-9-15(2)16(3)11-17/h5-12,14H,4H2,1-3H3/b19-12- |
| InChIKey | AJJGJLRJGBKFLY-UNOMPAQXSA-N |
| XLogP | 5.89 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|