C19H16N2S2 — CID 5345054
(E)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile (PubChem CID 5345054) has the molecular formula C19H16N2S2 and a molecular weight of 336.49 g/mol. Its IUPAC name is (E)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5345054 |
| Molecular Formula | C19H16N2S2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (E)-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(/C(C#N)=C/c3sccc3C)n2)cc1C |
| InChI | InChI=1S/C19H16N2S2/c1-12-4-5-15(8-14(12)3)17-11-23-19(21-17)16(10-20)9-18-13(2)6-7-22-18/h4-9,11H,1-3H3/b16-9+ |
| InChIKey | WILLOQBJQOPNTM-CXUHLZMHSA-N |
| XLogP | 5.86 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|