C17H10Cl2N2S2 — CID 7121393
(Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile (PubChem CID 7121393) has the molecular formula C17H10Cl2N2S2 and a molecular weight of 377.32 g/mol. Its IUPAC name is (Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7121393 |
| Molecular Formula | C17H10Cl2N2S2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | (Z)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccsc1/C=C(/C#N)c1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C17H10Cl2N2S2/c1-10-4-5-22-16(10)6-11(8-20)17-21-15(9-23-17)13-3-2-12(18)7-14(13)19/h2-7,9H,1H3/b11-6- |
| InChIKey | RWERNJBCNFDAQM-WDZFZDKYSA-N |
| XLogP | 6.55 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|