C14H9Cl2NS — CID 955574
(E)-2-(2,4-dichlorophenyl)-3-(3-methylthiophen-2-yl)prop-2-enenitrile (PubChem CID 955574) has the molecular formula C14H9Cl2NS and a molecular weight of 294.21 g/mol. Its IUPAC name is (E)-2-(2,4-dichlorophenyl)-3-(3-methylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,4-dichlorophenyl)-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 955574 |
| Molecular Formula | C14H9Cl2NS |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | (E)-2-(2,4-dichlorophenyl)-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccsc1/C=C(/C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl2NS/c1-9-4-5-18-14(9)6-10(8-17)12-3-2-11(15)7-13(12)16/h2-7H,1H3/b10-6- |
| InChIKey | NJLBGFUHRINBAK-POHAHGRESA-N |
| XLogP | 5.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|