C15H8Cl2N2O2 — CID 6017129
(Z)-2-(2,4-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 6017129) has the molecular formula C15H8Cl2N2O2 and a molecular weight of 319.15 g/mol. Its IUPAC name is (Z)-2-(2,4-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(2,4-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6017129 |
| Molecular Formula | C15H8Cl2N2O2 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | (Z)-2-(2,4-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H8Cl2N2O2/c16-12-4-5-14(15(17)8-12)11(9-18)6-10-2-1-3-13(7-10)19(20)21/h1-8H/b11-6+ |
| InChIKey | QLABAIQBQNWRFP-IZZDOVSWSA-N |
| XLogP | 4.97 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|