C19H10Cl2N2O3 — CID 4710166
2-(2,4-dichlorophenyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 4710166) has the molecular formula C19H10Cl2N2O3 and a molecular weight of 385.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4710166 |
| Molecular Formula | C19H10Cl2N2O3 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H10Cl2N2O3/c20-14-3-7-17(18(21)10-14)13(11-22)9-16-6-8-19(26-16)12-1-4-15(5-2-12)23(24)25/h1-10H |
| InChIKey | QJRWDVUONSCFOV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 80.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|