C20H10Cl2F3NO — CID 3444138
2-(2,4-dichlorophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile (PubChem CID 3444138) has the molecular formula C20H10Cl2F3NO and a molecular weight of 408.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3444138 |
| Molecular Formula | C20H10Cl2F3NO |
| Molecular Weight | 408.21 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H10Cl2F3NO/c21-15-4-6-17(18(22)10-15)13(11-26)9-16-5-7-19(27-16)12-2-1-3-14(8-12)20(23,24)25/h1-10H |
| InChIKey | ZQUXTOOGPNAWTO-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.21 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|