C21H11Cl2F3N2O2 — CID 18863852
(E)-3-[5-(3-chlorophenyl)furan-2-yl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide (PubChem CID 18863852) has the molecular formula C21H11Cl2F3N2O2 and a molecular weight of 451.23 g/mol. Its IUPAC name is (E)-3-[5-(3-chlorophenyl)furan-2-yl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-(3-chlorophenyl)furan-2-yl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 18863852 |
| Molecular Formula | C21H11Cl2F3N2O2 |
| Molecular Weight | 451.23 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | (E)-3-[5-(3-chlorophenyl)furan-2-yl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2cccc(Cl)c2)o1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H11Cl2F3N2O2/c22-15-3-1-2-12(8-15)19-7-5-16(30-19)9-13(11-27)20(29)28-18-10-14(21(24,25)26)4-6-17(18)23/h1-10H,(H,28,29)/b13-9+ |
| InChIKey | FELKBCJWZFDODZ-UKTHLTGXSA-N |
| XLogP | 6.82 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.23 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|