C22H12F3N3O2 — CID 18863823
(E)-2-cyano-N-(2-cyanophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide (PubChem CID 18863823) has the molecular formula C22H12F3N3O2 and a molecular weight of 407.35 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-cyanophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-cyanophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18863823 |
| Molecular Formula | C22H12F3N3O2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (E)-2-cyano-N-(2-cyanophenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2cccc(C(F)(F)F)c2)o1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C22H12F3N3O2/c23-22(24,25)17-6-3-5-14(10-17)20-9-8-18(30-20)11-16(13-27)21(29)28-19-7-2-1-4-15(19)12-26/h1-11H,(H,28,29)/b16-11+ |
| InChIKey | NTODCESFNLEUKD-LFIBNONCSA-N |
| XLogP | 5.38 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|