C20H12N4O6 — CID 18863676
(E)-2-cyano-N-(2-nitrophenyl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 18863676) has the molecular formula C20H12N4O6 and a molecular weight of 404.34 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-nitrophenyl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-nitrophenyl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18863676 |
| Molecular Formula | C20H12N4O6 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (E)-2-cyano-N-(2-nitrophenyl)-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2cccc([N+](=O)[O-])c2)o1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H12N4O6/c21-12-14(20(25)22-17-6-1-2-7-18(17)24(28)29)11-16-8-9-19(30-16)13-4-3-5-15(10-13)23(26)27/h1-11H,(H,22,25)/b14-11+ |
| InChIKey | QTZGUHMNROPUQI-SDNWHVSQSA-N |
| XLogP | 4.31 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|