C20H11ClN4O6 — CID 3326557
3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 3326557) has the molecular formula C20H11ClN4O6 and a molecular weight of 438.78 g/mol. Its IUPAC name is 3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | 3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3326557 |
| Molecular Formula | C20H11ClN4O6 |
| Molecular Weight | 438.78 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H11ClN4O6/c21-16-10-13(24(27)28)5-7-15(16)19-8-6-14(31-19)9-12(11-22)20(26)23-17-3-1-2-4-18(17)25(29)30/h1-10H,(H,23,26) |
| InChIKey | YRYOBBCFQSDLSO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.78 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|