C21H12BrN3O6 — CID 45465707
2-[[(E)-3-[5-(2-bromo-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 45465707) has the molecular formula C21H12BrN3O6 and a molecular weight of 482.25 g/mol. Its IUPAC name is 2-[[(E)-3-[5-(2-bromo-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-[5-(2-bromo-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 45465707 |
| Molecular Formula | C21H12BrN3O6 |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 2-[[(E)-3-[5-(2-bromo-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc([N+](=O)[O-])cc2Br)o1)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C21H12BrN3O6/c22-17-10-13(25(29)30)5-7-15(17)19-8-6-14(31-19)9-12(11-23)20(26)24-18-4-2-1-3-16(18)21(27)28/h1-10H,(H,24,26)(H,27,28)/b12-9+ |
| InChIKey | IBVGDWAMTXBWIF-FMIVXFBMSA-N |
| XLogP | 4.86 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|