C20H10BrClFN3O4 — CID 1128259
(E)-N-(4-bromo-2-fluorophenyl)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enamide (PubChem CID 1128259) has the molecular formula C20H10BrClFN3O4 and a molecular weight of 490.67 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-fluorophenyl)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-fluorophenyl)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 1128259 |
| Molecular Formula | C20H10BrClFN3O4 |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | (E)-N-(4-bromo-2-fluorophenyl)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C20H10BrClFN3O4/c21-12-1-5-18(17(23)8-12)25-20(27)11(10-24)7-14-3-6-19(30-14)15-4-2-13(26(28)29)9-16(15)22/h1-9H,(H,25,27)/b11-7+ |
| InChIKey | KSGYEWPHCBATMR-YRNVUSSQSA-N |
| XLogP | 5.96 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|