C23H13ClN4O4S — CID 170911967
(Z)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170911967) has the molecular formula C23H13ClN4O4S and a molecular weight of 476.90 g/mol. Its IUPAC name is (Z)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170911967 |
| Molecular Formula | C23H13ClN4O4S |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | (Z)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-cyano-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H13ClN4O4S/c24-19-11-16(28(30)31)6-8-18(19)21-9-7-17(32-21)10-15(12-25)22(29)27-23-26-20(13-33-23)14-4-2-1-3-5-14/h1-11,13H,(H,26,27,29)/b15-10- |
| InChIKey | JRFDAWYZCQVKAQ-GDNBJRDFSA-N |
| XLogP | 6.18 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|