C24H19F3N2O2 — CID 126227435
(Z)-2-cyano-N-(3-phenylpropyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide (PubChem CID 126227435) has the molecular formula C24H19F3N2O2 and a molecular weight of 424.42 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-phenylpropyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-phenylpropyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126227435 |
| Molecular Formula | C24H19F3N2O2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (Z)-2-cyano-N-(3-phenylpropyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(-c2cccc(C(F)(F)F)c2)o1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C24H19F3N2O2/c25-24(26,27)20-10-4-9-18(14-20)22-12-11-21(31-22)15-19(16-28)23(30)29-13-5-8-17-6-2-1-3-7-17/h1-4,6-7,9-12,14-15H,5,8,13H2,(H,29,30)/b19-15- |
| InChIKey | NDCWJLJCICNLEU-CYVLTUHYSA-N |
| XLogP | 5.62 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|