C23H17F3N2O2 — CID 1178610
2-cyano-N-(2-phenylethyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide (PubChem CID 1178610) has the molecular formula C23H17F3N2O2 and a molecular weight of 410.40 g/mol. Its IUPAC name is 2-cyano-N-(2-phenylethyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2-phenylethyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1178610 |
| Molecular Formula | C23H17F3N2O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-cyano-N-(2-phenylethyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C23H17F3N2O2/c24-23(25,26)19-8-4-7-17(13-19)21-10-9-20(30-21)14-18(15-27)22(29)28-12-11-16-5-2-1-3-6-16/h1-10,13-14H,11-12H2,(H,28,29) |
| InChIKey | MLTRRBOUJNTJRD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|