C24H21N3O4 — CID 126239289
(Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126239289) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126239289 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=C(/C#N)C(=O)NCCCc2ccccc2)o1 |
| InChI | InChI=1S/C24H21N3O4/c1-17-9-10-20(27(29)30)15-22(17)23-12-11-21(31-23)14-19(16-25)24(28)26-13-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3,(H,26,28)/b19-14- |
| InChIKey | KDQNTSBDTWVTTM-RGEXLXHISA-N |
| XLogP | 4.82 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|