C17H10Cl2N4O3 — CID 6280065
(E)-2-cyano-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 6280065) has the molecular formula C17H10Cl2N4O3 and a molecular weight of 389.20 g/mol. Its IUPAC name is (E)-2-cyano-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6280065 |
| Molecular Formula | C17H10Cl2N4O3 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | (E)-2-cyano-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cccc([N+](=O)[O-])c1)C(=O)N/N=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl2N4O3/c18-14-5-4-12(16(19)8-14)10-21-22-17(24)13(9-20)6-11-2-1-3-15(7-11)23(25)26/h1-8,10H,(H,22,24)/b13-6+,21-10- |
| InChIKey | OJGXQUKIQKDLFC-DFFUUUHGSA-N |
| XLogP | 3.96 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|