C17H12N4O4 — CID 135821742
2-cyano-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 135821742) has the molecular formula C17H12N4O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 2-cyano-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135821742 |
| Molecular Formula | C17H12N4O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-cyano-N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cccc([N+](=O)[O-])c1)C(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C17H12N4O4/c18-10-14(8-12-4-3-6-15(9-12)21(24)25)17(23)20-19-11-13-5-1-2-7-16(13)22/h1-9,11,22H,(H,20,23)/b14-8?,19-11+ |
| InChIKey | SYVYNJUBJGGGMJ-UWSYIEHGSA-N |
| XLogP | 2.36 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|