C20H12Cl2N4O3S — CID 4673747
2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 4673747) has the molecular formula C20H12Cl2N4O3S and a molecular weight of 459.31 g/mol. Its IUPAC name is 2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4673747 |
| Molecular Formula | C20H12Cl2N4O3S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 2-cyano-N-[5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1ncc(Cc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C20H12Cl2N4O3S/c21-15-5-4-13(18(22)9-15)8-17-11-24-20(30-17)25-19(27)14(10-23)6-12-2-1-3-16(7-12)26(28)29/h1-7,9,11H,8H2,(H,24,25,27) |
| InChIKey | YKCIZAZPWOWIDC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|