C17H11Cl2N3O3S — CID 1113549
N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 1113549) has the molecular formula C17H11Cl2N3O3S and a molecular weight of 408.27 g/mol. Its IUPAC name is N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1113549 |
| Molecular Formula | C17H11Cl2N3O3S |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | O=C(Nc1ncc(Cc2cc(Cl)ccc2Cl)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11Cl2N3O3S/c18-12-4-5-15(19)11(6-12)8-14-9-20-17(26-14)21-16(23)10-2-1-3-13(7-10)22(24)25/h1-7,9H,8H2,(H,20,21,23) |
| InChIKey | OQZGYZJXJBTGJI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|