C19H13Cl2N3OS2 — CID 2381741
(E)-2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(5-methylthiophen-2-yl)prop-2-enamide (PubChem CID 2381741) has the molecular formula C19H13Cl2N3OS2 and a molecular weight of 434.37 g/mol. Its IUPAC name is (E)-2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(5-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(5-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2381741 |
| Molecular Formula | C19H13Cl2N3OS2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | (E)-2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(5-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)Nc2ncc(Cc3cc(Cl)ccc3Cl)s2)s1 |
| InChI | InChI=1S/C19H13Cl2N3OS2/c1-11-2-4-15(26-11)8-13(9-22)18(25)24-19-23-10-16(27-19)7-12-6-14(20)3-5-17(12)21/h2-6,8,10H,7H2,1H3,(H,23,24,25)/b13-8+ |
| InChIKey | GHRKKRDZPGLXMX-MDWZMJQESA-N |
| XLogP | 5.96 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|