C24H13Cl4N3O2S — CID 3311815
2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 3311815) has the molecular formula C24H13Cl4N3O2S and a molecular weight of 549.27 g/mol. Its IUPAC name is 2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3311815 |
| Molecular Formula | C24H13Cl4N3O2S |
| Molecular Weight | 549.27 g/mol |
| Exact Mass | 546.95 |
| IUPAC Name | 2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2cc(Cl)ccc2Cl)o1)C(=O)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C24H13Cl4N3O2S/c25-15-1-4-20(27)13(7-15)9-18-12-30-24(34-18)31-23(32)14(11-29)8-17-3-6-22(33-17)19-10-16(26)2-5-21(19)28/h1-8,10,12H,9H2,(H,30,31,32) |
| InChIKey | IIVWVCHARFGGPV-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.27 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|