C24H14Cl2FN3O2S — CID 3393948
2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3393948) has the molecular formula C24H14Cl2FN3O2S and a molecular weight of 498.37 g/mol. Its IUPAC name is 2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3393948 |
| Molecular Formula | C24H14Cl2FN3O2S |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 2-cyano-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2ccccc2F)o1)C(=O)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C24H14Cl2FN3O2S/c25-16-5-7-20(26)14(9-16)11-18-13-29-24(33-18)30-23(31)15(12-28)10-17-6-8-22(32-17)19-3-1-2-4-21(19)27/h1-10,13H,11H2,(H,29,30,31) |
| InChIKey | DSXXOCDYORDMPX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|