C29H24ClN3O4S — CID 2088571
butyl 4-[5-[(Z)-3-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 2088571) has the molecular formula C29H24ClN3O4S and a molecular weight of 546.05 g/mol. Its IUPAC name is butyl 4-[5-[(Z)-3-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | butyl 4-[5-[(Z)-3-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2088571 |
| Molecular Formula | C29H24ClN3O4S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | butyl 4-[5-[(Z)-3-[[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(/C=C(/C#N)C(=O)Nc3ncc(Cc4ccccc4Cl)s3)o2)cc1 |
| InChI | InChI=1S/C29H24ClN3O4S/c1-2-3-14-36-28(35)20-10-8-19(9-11-20)26-13-12-23(37-26)15-22(17-31)27(34)33-29-32-18-24(38-29)16-21-6-4-5-7-25(21)30/h4-13,15,18H,2-3,14,16H2,1H3,(H,32,33,34)/b22-15- |
| InChIKey | BCPXWPLHORCAOC-JCMHNJIXSA-N |
| XLogP | 7.15 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|