C25H17ClN4O4S — CID 170918639
ethyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 170918639) has the molecular formula C25H17ClN4O4S and a molecular weight of 504.96 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 170918639 |
| Molecular Formula | C25H17ClN4O4S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | ethyl 4-[5-[(Z)-3-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-2-cyano-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C(/C#N)C(=O)Nc3nnc(-c4ccccc4Cl)s3)o2)cc1 |
| InChI | InChI=1S/C25H17ClN4O4S/c1-2-33-24(32)16-9-7-15(8-10-16)21-12-11-18(34-21)13-17(14-27)22(31)28-25-30-29-23(35-25)19-5-3-4-6-20(19)26/h3-13H,2H2,1H3,(H,28,30,31)/b17-13- |
| InChIKey | FLBBURXTMXAXTB-LGMDPLHJSA-N |
| XLogP | 5.84 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|