C22H18N2O5 — CID 6384498
ethyl 4-[5-[(Z)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 6384498) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6384498 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl 4-[5-[(Z)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C(/C#N)C(=O)NCc3ccco3)o2)cc1 |
| InChI | InChI=1S/C22H18N2O5/c1-2-27-22(26)16-7-5-15(6-8-16)20-10-9-18(29-20)12-17(13-23)21(25)24-14-19-4-3-11-28-19/h3-12H,2,14H2,1H3,(H,24,25)/b17-12- |
| InChIKey | HCYLRULMGYMICH-ATVHPVEESA-N |
| XLogP | 3.94 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|