C21H19N3O6 — CID 9352907
ethyl 4-[5-[(Z)-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 9352907) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 9352907 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | ethyl 4-[5-[(Z)-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N\NC(=O)C(=O)NCc3ccco3)o2)cc1 |
| InChI | InChI=1S/C21H19N3O6/c1-2-28-21(27)15-7-5-14(6-8-15)18-10-9-17(30-18)13-23-24-20(26)19(25)22-12-16-4-3-11-29-16/h3-11,13H,2,12H2,1H3,(H,22,25)(H,24,26)/b23-13- |
| InChIKey | ZEUPYNLJWUKYOQ-QRVIBDJDSA-N |
| XLogP | 2.48 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|