C12H10N4O6 — CID 9352807
N-(furan-2-ylmethyl)-N'-[(Z)-(5-nitrofuran-2-yl)methylideneamino]oxamide (PubChem CID 9352807) has the molecular formula C12H10N4O6 and a molecular weight of 306.23 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(Z)-(5-nitrofuran-2-yl)methylideneamino]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(Z)-(5-nitrofuran-2-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 9352807 |
| Molecular Formula | C12H10N4O6 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(Z)-(5-nitrofuran-2-yl)methylideneamino]oxamide |
| SMILES | O=C(NCc1ccco1)C(=O)N/N=C\c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H10N4O6/c17-11(13-6-8-2-1-5-21-8)12(18)15-14-7-9-3-4-10(22-9)16(19)20/h1-5,7H,6H2,(H,13,17)(H,15,18)/b14-7- |
| InChIKey | HAIDJSQVNZOHCF-AUWJEWJLSA-N |
| XLogP | 0.55 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|