C8H9N3O6 — CID 6433366
2-hydroxyethyl N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]carbamate (PubChem CID 6433366) has the molecular formula C8H9N3O6 and a molecular weight of 243.17 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]carbamate.
| Compound Name | 2-hydroxyethyl N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 6433366 |
| Molecular Formula | C8H9N3O6 |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-hydroxyethyl N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]carbamate |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])o1)OCCO |
| InChI | InChI=1S/C8H9N3O6/c12-3-4-16-8(13)10-9-5-6-1-2-7(17-6)11(14)15/h1-2,5,12H,3-4H2,(H,10,13)/b9-5- |
| InChIKey | ZEOZJBSXGJMHAQ-UITAMQMPSA-N |
| XLogP | 0.24 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|