C6H9N4O8P — CID 139205306
[(E)-(5-nitrofuran-2-yl)methylideneamino]urea;phosphoric acid (PubChem CID 139205306) has the molecular formula C6H9N4O8P and a molecular weight of 296.13 g/mol. Its IUPAC name is [(E)-(5-nitrofuran-2-yl)methylideneamino]urea;phosphoric acid.
| Compound Name | [(E)-(5-nitrofuran-2-yl)methylideneamino]urea;phosphoric acid |
|---|---|
| PubChem CID | 139205306 |
| Molecular Formula | C6H9N4O8P |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | [(E)-(5-nitrofuran-2-yl)methylideneamino]urea;phosphoric acid |
| SMILES | NC(=O)N/N=C/c1ccc([N+](=O)[O-])o1.O=P(O)(O)O |
| InChI | InChI=1S/C6H6N4O4.H3O4P/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13;1-5(2,3)4/h1-3H,(H3,7,9,11);(H3,1,2,3,4)/b8-3+; |
| InChIKey | XSFLANGHQBQNDV-DCDCITSCSA-N |
| XLogP | -0.74 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|