C9H13N5O5 — CID 174920742
N,N-dimethylformamide;[(E)-(5-nitrofuran-2-yl)methylideneamino]urea (PubChem CID 174920742) has the molecular formula C9H13N5O5 and a molecular weight of 271.23 g/mol. Its IUPAC name is N,N-dimethylformamide;[(E)-(5-nitrofuran-2-yl)methylideneamino]urea.
| Compound Name | N,N-dimethylformamide;[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 174920742 |
| Molecular Formula | C9H13N5O5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N,N-dimethylformamide;[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
| SMILES | CN(C)C=O.NC(=O)N/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C6H6N4O4.C3H7NO/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13;1-4(2)3-5/h1-3H,(H3,7,9,11);3H,1-2H3/b8-3+; |
| InChIKey | ZXUKRIDNUSVYGJ-DCDCITSCSA-N |
| XLogP | -0.11 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|