C14H19N3O4 — CID 24840585
(E)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]non-2-enamide (PubChem CID 24840585) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (E)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]non-2-enamide.
| Compound Name | (E)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]non-2-enamide |
|---|---|
| PubChem CID | 24840585 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (E)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]non-2-enamide |
| SMILES | CCCCCC/C=C/C(=O)N/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H19N3O4/c1-2-3-4-5-6-7-8-13(18)16-15-11-12-9-10-14(21-12)17(19)20/h7-11H,2-6H2,1H3,(H,16,18)/b8-7+,15-11+ |
| InChIKey | AZJPXKAPSIEJDK-XHBXSBNISA-N |
| XLogP | 3.16 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|