C11H15N5O6 — CID 134124807
butyl N-[[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoylamino]carbamate (PubChem CID 134124807) has the molecular formula C11H15N5O6 and a molecular weight of 313.27 g/mol. Its IUPAC name is butyl N-[[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoylamino]carbamate.
| Compound Name | butyl N-[[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoylamino]carbamate |
|---|---|
| PubChem CID | 134124807 |
| Molecular Formula | C11H15N5O6 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | butyl N-[[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamoylamino]carbamate |
| SMILES | CCCCOC(=O)NNC(=O)N/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H15N5O6/c1-2-3-6-21-11(18)15-14-10(17)13-12-7-8-4-5-9(22-8)16(19)20/h4-5,7H,2-3,6H2,1H3,(H,15,18)(H2,13,14,17)/b12-7+ |
| InChIKey | VBDYHDZJAWJMQR-KPKJPENVSA-N |
| XLogP | 1.26 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|