C14H11Cl2N3O3 — CID 3639145
N'-[(2,3-dichlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 3639145) has the molecular formula C14H11Cl2N3O3 and a molecular weight of 340.17 g/mol. Its IUPAC name is N'-[(2,3-dichlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(2,3-dichlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 3639145 |
| Molecular Formula | C14H11Cl2N3O3 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N'-[(2,3-dichlorophenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccco1)C(=O)NN=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H11Cl2N3O3/c15-11-5-1-3-9(12(11)16)7-18-19-14(21)13(20)17-8-10-4-2-6-22-10/h1-7H,8H2,(H,17,20)(H,19,21) |
| InChIKey | SURVBCPEYWKBDL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|